C16H24N4O2 — CID 156795295
ethane;3-[(8-ethylimidazo[1,2-a]pyridin-3-yl)-methylamino]-N-formylpropanamide (PubChem CID 156795295) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is ethane;3-[(8-ethylimidazo[1,2-a]pyridin-3-yl)-methylamino]-N-formylpropanamide.
| Compound Name | ethane;3-[(8-ethylimidazo[1,2-a]pyridin-3-yl)-methylamino]-N-formylpropanamide |
|---|---|
| PubChem CID | 156795295 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | ethane;3-[(8-ethylimidazo[1,2-a]pyridin-3-yl)-methylamino]-N-formylpropanamide |
| SMILES | CC.CCc1cccn2c(N(C)CCC(=O)NC=O)cnc12 |
| InChI | InChI=1S/C14H18N4O2.C2H6/c1-3-11-5-4-7-18-13(9-15-14(11)18)17(2)8-6-12(20)16-10-19;1-2/h4-5,7,9-10H,3,6,8H2,1-2H3,(H,16,19,20);1-2H3 |
| InChIKey | BDJLYJCITOFPNN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|