C14H19F2NO2 — CID 176933071
2-ethyl-1,3-difluorobenzene;N-formylpentanamide (PubChem CID 176933071) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-ethyl-1,3-difluorobenzene;N-formylpentanamide.
| Compound Name | 2-ethyl-1,3-difluorobenzene;N-formylpentanamide |
|---|---|
| PubChem CID | 176933071 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-ethyl-1,3-difluorobenzene;N-formylpentanamide |
| SMILES | CCCCC(=O)NC=O.CCc1c(F)cccc1F |
| InChI | InChI=1S/C8H8F2.C6H11NO2/c1-2-6-7(9)4-3-5-8(6)10;1-2-3-4-6(9)7-5-8/h3-5H,2H2,1H3;5H,2-4H2,1H3,(H,7,8,9) |
| InChIKey | RXFFSNMFFWXFQQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|