C27H19N3O3S — CID 156795883
methyl 5-(benzhydrylideneamino)-2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate (PubChem CID 156795883) has the molecular formula C27H19N3O3S and a molecular weight of 465.53 g/mol. Its IUPAC name is methyl 5-(benzhydrylideneamino)-2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-(benzhydrylideneamino)-2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 156795883 |
| Molecular Formula | C27H19N3O3S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | methyl 5-(benzhydrylideneamino)-2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(C(=O)c2c[nH]c3ccccc23)sc1N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H19N3O3S/c1-33-27(32)23-25(29-22(17-10-4-2-5-11-17)18-12-6-3-7-13-18)34-26(30-23)24(31)20-16-28-21-15-9-8-14-19(20)21/h2-16,28H,1H3 |
| InChIKey | UUASGSFQHCLFTR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|