C12H28N2 — CID 156797046
ethane;(E)-5-(ethylideneamino)-N,3,4-trimethylpent-4-en-1-amine;molecular hydrogen (PubChem CID 156797046) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is ethane;(E)-5-(ethylideneamino)-N,3,4-trimethylpent-4-en-1-amine;molecular hydrogen.
| Compound Name | ethane;(E)-5-(ethylideneamino)-N,3,4-trimethylpent-4-en-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 156797046 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | ethane;(E)-5-(ethylideneamino)-N,3,4-trimethylpent-4-en-1-amine;molecular hydrogen |
| SMILES | C/C=N/C=C(\C)C(C)CCNC.CC.[H][H] |
| InChI | InChI=1S/C10H20N2.C2H6.H2/c1-5-12-8-10(3)9(2)6-7-11-4;1-2;/h5,8-9,11H,6-7H2,1-4H3;1-2H3;1H/b10-8+,12-5+;; |
| InChIKey | ZNMWIRDEHOMINZ-HTGHOWHISA-N |
| XLogP | 3.50 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|