C13H26N2 — CID 123313909
5,6-dimethyl-7-(methylideneamino)-N-propylhept-6-en-1-amine (PubChem CID 123313909) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 5,6-dimethyl-7-(methylideneamino)-N-propylhept-6-en-1-amine.
| Compound Name | 5,6-dimethyl-7-(methylideneamino)-N-propylhept-6-en-1-amine |
|---|---|
| PubChem CID | 123313909 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 5,6-dimethyl-7-(methylideneamino)-N-propylhept-6-en-1-amine |
| SMILES | C=NC=C(C)C(C)CCCCNCCC |
| InChI | InChI=1S/C13H26N2/c1-5-9-15-10-7-6-8-12(2)13(3)11-14-4/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | RALNWDBFGSRTHM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|