C11H24N2 — CID 123823524
5-ethyl-N,N,2-trimethylhex-1-ene-1,6-diamine (PubChem CID 123823524) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 5-ethyl-N,N,2-trimethylhex-1-ene-1,6-diamine.
| Compound Name | 5-ethyl-N,N,2-trimethylhex-1-ene-1,6-diamine |
|---|---|
| PubChem CID | 123823524 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 5-ethyl-N,N,2-trimethylhex-1-ene-1,6-diamine |
| SMILES | CCC(CN)CCC(C)=CN(C)C |
| InChI | InChI=1S/C11H24N2/c1-5-11(8-12)7-6-10(2)9-13(3)4/h9,11H,5-8,12H2,1-4H3 |
| InChIKey | ADTBEIPBKUYFEH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |