C26H28F5N5OS — CID 156797513
1-[(2R,6S)-4-[3-amino-9-(2,4-difluorophenyl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine-6-carboximidoyl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 156797513) has the molecular formula C26H28F5N5OS and a molecular weight of 553.60 g/mol. Its IUPAC name is 1-[(2R,6S)-4-[3-amino-9-(2,4-difluorophenyl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine-6-carboximidoyl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,6S)-4-[3-amino-9-(2,4-difluorophenyl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine-6-carboximidoyl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156797513 |
| Molecular Formula | C26H28F5N5OS |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 1-[(2R,6S)-4-[3-amino-9-(2,4-difluorophenyl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1,5-benzothiazepine-6-carboximidoyl]-2,6-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C(/c1cc(C(F)(F)F)c(-c2ccc(F)cc2F)c2c1NCC(N)CS2)N1C[C@@H](C)N(C(=O)C=C)[C@@H](C)C1 |
| InChI | InChI=1S/C26H28F5N5OS/c1-4-21(37)36-13(2)10-35(11-14(36)3)25(33)18-8-19(26(29,30)31)22(17-6-5-15(27)7-20(17)28)24-23(18)34-9-16(32)12-38-24/h4-8,13-14,16,33-34H,1,9-12,32H2,2-3H3/b33-25-/t13-,14+,16? |
| InChIKey | JLCGIOJEGHKNHG-XZELZLLYSA-N |
| XLogP | 4.93 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|