C28H30F5N7O2S — CID 156797559
12-[amino(methyl)amino]-8-(2,4-difluorophenyl)-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one;ethenamine (PubChem CID 156797559) has the molecular formula C28H30F5N7O2S and a molecular weight of 623.65 g/mol. Its IUPAC name is 12-[amino(methyl)amino]-8-(2,4-difluorophenyl)-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one;ethenamine.
| Compound Name | 12-[amino(methyl)amino]-8-(2,4-difluorophenyl)-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one;ethenamine |
|---|---|
| PubChem CID | 156797559 |
| Molecular Formula | C28H30F5N7O2S |
| Molecular Weight | 623.65 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | 12-[amino(methyl)amino]-8-(2,4-difluorophenyl)-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one;ethenamine |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5F)c(C(F)(F)F)cc24)SCC(N(C)N)C3)CC1.C=CN |
| InChI | InChI=1S/C26H25F5N6O2S.C2H5N/c1-3-20(38)35-6-8-36(9-7-35)24-17-11-18(26(29,30)31)21(16-5-4-14(27)10-19(16)28)23-22(17)37(25(39)33-24)12-15(13-40-23)34(2)32;1-2-3/h3-5,10-11,15H,1,6-9,12-13,32H2,2H3;2H,1,3H2 |
| InChIKey | FGFRMEXGZBWCJA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.65 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|