C27H25F5N4O3S — CID 169267951
8-(2,4-difluorophenyl)-12-methoxy-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 169267951) has the molecular formula C27H25F5N4O3S and a molecular weight of 580.58 g/mol. Its IUPAC name is 8-(2,4-difluorophenyl)-12-methoxy-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | 8-(2,4-difluorophenyl)-12-methoxy-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 169267951 |
| Molecular Formula | C27H25F5N4O3S |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 8-(2,4-difluorophenyl)-12-methoxy-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5F)c(C(F)(F)F)cc24)SCC(OC)C3)[C@@H](C)C1 |
| InChI | InChI=1S/C27H25F5N4O3S/c1-4-21(37)34-7-8-35(14(2)11-34)25-18-10-19(27(30,31)32)22(17-6-5-15(28)9-20(17)29)24-23(18)36(26(38)33-25)12-16(39-3)13-40-24/h4-6,9-10,14,16H,1,7-8,11-13H2,2-3H3/t14-,16?/m0/s1 |
| InChIKey | OJYMXDNEHBOFQU-LBAUFKAWSA-N |
| XLogP | 4.70 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|