C16H30N2O3 — CID 156798942
(E)-4-methyl-N-[1-(2-propan-2-yloxyacetyl)piperidin-4-yl]pent-2-enamide;molecular hydrogen (PubChem CID 156798942) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is (E)-4-methyl-N-[1-(2-propan-2-yloxyacetyl)piperidin-4-yl]pent-2-enamide;molecular hydrogen.
| Compound Name | (E)-4-methyl-N-[1-(2-propan-2-yloxyacetyl)piperidin-4-yl]pent-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 156798942 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (E)-4-methyl-N-[1-(2-propan-2-yloxyacetyl)piperidin-4-yl]pent-2-enamide;molecular hydrogen |
| SMILES | CC(C)/C=C/C(=O)NC1CCN(C(=O)COC(C)C)CC1.[H][H] |
| InChI | InChI=1S/C16H28N2O3.H2/c1-12(2)5-6-15(19)17-14-7-9-18(10-8-14)16(20)11-21-13(3)4;/h5-6,12-14H,7-11H2,1-4H3,(H,17,19);1H/b6-5+; |
| InChIKey | LAWBJNRCCFOPHV-IPZCTEOASA-N |
| XLogP | 1.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|