C13H15F2N3O3 — CID 156799486
(2,2-difluoroethanimidoyl) 2-oxo-1-(oxolan-2-ylmethyl)pyridine-4-carboximidate (PubChem CID 156799486) has the molecular formula C13H15F2N3O3 and a molecular weight of 299.28 g/mol. Its IUPAC name is (2,2-difluoroethanimidoyl) 2-oxo-1-(oxolan-2-ylmethyl)pyridine-4-carboximidate.
| Compound Name | (2,2-difluoroethanimidoyl) 2-oxo-1-(oxolan-2-ylmethyl)pyridine-4-carboximidate |
|---|---|
| PubChem CID | 156799486 |
| Molecular Formula | C13H15F2N3O3 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (2,2-difluoroethanimidoyl) 2-oxo-1-(oxolan-2-ylmethyl)pyridine-4-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])C(F)F)c1ccn(CC2CCCO2)c(=O)c1 |
| InChI | InChI=1S/C13H15F2N3O3/c14-11(15)13(17)21-12(16)8-3-4-18(10(19)6-8)7-9-2-1-5-20-9/h3-4,6,9,11,16-17H,1-2,5,7H2/b16-12-,17-13+ |
| InChIKey | HFOUDZSYJGSQKH-RFTYBOQRSA-N |
| XLogP | 1.61 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|