C9H15NO — CID 156799800
(Z,5Z)-5-(aminomethylidene)-2-methylidenehept-3-en-1-ol (PubChem CID 156799800) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (Z,5Z)-5-(aminomethylidene)-2-methylidenehept-3-en-1-ol.
| Compound Name | (Z,5Z)-5-(aminomethylidene)-2-methylidenehept-3-en-1-ol |
|---|---|
| PubChem CID | 156799800 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (Z,5Z)-5-(aminomethylidene)-2-methylidenehept-3-en-1-ol |
| SMILES | C=C(/C=C\C(=C/N)CC)CO |
| InChI | InChI=1S/C9H15NO/c1-3-9(6-10)5-4-8(2)7-11/h4-6,11H,2-3,7,10H2,1H3/b5-4-,9-6- |
| InChIKey | IEMIXQLPNNSWIS-WXOLFVLTSA-N |
| XLogP | 1.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|