C19H26N2O3 — CID 156800058
tert-butyl 2-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate;ethane (PubChem CID 156800058) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 2-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate;ethane.
| Compound Name | tert-butyl 2-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate;ethane |
|---|---|
| PubChem CID | 156800058 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl 2-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate;ethane |
| SMILES | C=C(Cc1nc(-c2ccc(C)cc2)no1)C(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C17H20N2O3.C2H6/c1-11-6-8-13(9-7-11)15-18-14(22-19-15)10-12(2)16(20)21-17(3,4)5;1-2/h6-9H,2,10H2,1,3-5H3;1-2H3 |
| InChIKey | MVRNHMNHUQKJLI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|