C28H27ClIN3O5 — CID 15680019
2-[(1-methylpyridin-1-ium-3-carbonyl)amino]ethyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate iodide (PubChem CID 15680019) has the molecular formula C28H27ClIN3O5 and a molecular weight of 647.90 g/mol. Its IUPAC name is 2-[(1-methylpyridin-1-ium-3-carbonyl)amino]ethyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate iodide.
| Compound Name | 2-[(1-methylpyridin-1-ium-3-carbonyl)amino]ethyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate iodide |
|---|---|
| PubChem CID | 15680019 |
| Molecular Formula | C28H27ClIN3O5 |
| Molecular Weight | 647.90 g/mol |
| Exact Mass | 647.07 |
| IUPAC Name | 2-[(1-methylpyridin-1-ium-3-carbonyl)amino]ethyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate iodide |
| SMILES | COc1ccc2c(c1)c(CC(=O)OCCNC(=O)c1ccc[n+](C)c1)c(C)n2C(=O)c1ccc(Cl)cc1.[I-] |
| InChI | InChI=1S/C28H26ClN3O5.HI/c1-18-23(16-26(33)37-14-12-30-27(34)20-5-4-13-31(2)17-20)24-15-22(36-3)10-11-25(24)32(18)28(35)19-6-8-21(29)9-7-19;/h4-11,13,15,17H,12,14,16H2,1-3H3;1H |
| InChIKey | KKSAQFKQYLTROB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.90 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|