C15H18N2O4 — CID 156801941
2-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-nitrophenyl]acetaldehyde;methanol (PubChem CID 156801941) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-nitrophenyl]acetaldehyde;methanol.
| Compound Name | 2-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-nitrophenyl]acetaldehyde;methanol |
|---|---|
| PubChem CID | 156801941 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-2-nitrophenyl]acetaldehyde;methanol |
| SMILES | C=C/C=C(\C=C)Nc1ccc([N+](=O)[O-])c(CC=O)c1.CO |
| InChI | InChI=1S/C14H14N2O3.CH4O/c1-3-5-12(4-2)15-13-6-7-14(16(18)19)11(10-13)8-9-17;1-2/h3-7,9-10,15H,1-2,8H2;2H,1H3/b12-5+; |
| InChIKey | YQBHJWFDOJQEIS-NKPNRJPBSA-N |
| XLogP | 2.61 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|