C15H17NO2 — CID 169219203
4-[(3E)-hexa-1,3,5-trien-3-yl]-1-nitro-2-propan-2-ylbenzene (PubChem CID 169219203) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]-1-nitro-2-propan-2-ylbenzene.
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-1-nitro-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 169219203 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-1-nitro-2-propan-2-ylbenzene |
| SMILES | C=C/C=C(\C=C)c1ccc([N+](=O)[O-])c(C(C)C)c1 |
| InChI | InChI=1S/C15H17NO2/c1-5-7-12(6-2)13-8-9-15(16(17)18)14(10-13)11(3)4/h5-11H,1-2H2,3-4H3/b12-7+ |
| InChIKey | OWUXAFBIYBOPQC-KPKJPENVSA-N |
| XLogP | 4.47 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|