C17H19AlN4O2 — CID 156802014
CID 156802014 (PubChem CID 156802014) has the molecular formula C17H19AlN4O2 and a molecular weight of 338.35 g/mol.
| Compound Name | CID 156802014 |
|---|---|
| PubChem CID | 156802014 |
| Molecular Formula | C17H19AlN4O2 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | — |
| SMILES | CC[C@@H]1CN(c2cc(=O)n(C)c3ccc(C#N)nc23)CC[C@H]1O[Al] |
| InChI | InChI=1S/C17H19N4O2.Al/c1-3-11-10-21(7-6-15(11)22)14-8-16(23)20(2)13-5-4-12(9-18)19-17(13)14;/h4-5,8,11,15H,3,6-7,10H2,1-2H3;/q-1;+1/t11-,15-;/m1./s1 |
| InChIKey | ZTBLPJPQSQKZKN-GPKQSYPGSA-N |
| XLogP | 1.51 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |