C15H31NO — CID 156802605
N-(2,4-dimethyl-2-propan-2-ylhexyl)-N-propan-2-ylformamide (PubChem CID 156802605) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is N-(2,4-dimethyl-2-propan-2-ylhexyl)-N-propan-2-ylformamide.
| Compound Name | N-(2,4-dimethyl-2-propan-2-ylhexyl)-N-propan-2-ylformamide |
|---|---|
| PubChem CID | 156802605 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | N-(2,4-dimethyl-2-propan-2-ylhexyl)-N-propan-2-ylformamide |
| SMILES | CCC(C)CC(C)(CN(C=O)C(C)C)C(C)C |
| InChI | InChI=1S/C15H31NO/c1-8-14(6)9-15(7,12(2)3)10-16(11-17)13(4)5/h11-14H,8-10H2,1-7H3 |
| InChIKey | RMPBKCHLVLRHKK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|