C10H22FNO — CID 156802611
N-[3-(2-fluoroethoxy)propyl]-N,2-dimethylpropan-1-amine (PubChem CID 156802611) has the molecular formula C10H22FNO and a molecular weight of 191.29 g/mol. Its IUPAC name is N-[3-(2-fluoroethoxy)propyl]-N,2-dimethylpropan-1-amine.
| Compound Name | N-[3-(2-fluoroethoxy)propyl]-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 156802611 |
| Molecular Formula | C10H22FNO |
| Molecular Weight | 191.29 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N-[3-(2-fluoroethoxy)propyl]-N,2-dimethylpropan-1-amine |
| SMILES | CC(C)CN(C)CCCOCCF |
| InChI | InChI=1S/C10H22FNO/c1-10(2)9-12(3)6-4-7-13-8-5-11/h10H,4-9H2,1-3H3 |
| InChIKey | DGCYNZNGIVTEHD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|