C16H23ClFN3O5 — CID 156803033
tert-butyl 3-[(5-chloro-6-fluoro-3-nitro-2-pyridinyl)oxy]azetidine-1-carboxylate;propane (PubChem CID 156803033) has the molecular formula C16H23ClFN3O5 and a molecular weight of 391.83 g/mol. Its IUPAC name is tert-butyl 3-[(5-chloro-6-fluoro-3-nitro-2-pyridinyl)oxy]azetidine-1-carboxylate;propane.
| Compound Name | tert-butyl 3-[(5-chloro-6-fluoro-3-nitro-2-pyridinyl)oxy]azetidine-1-carboxylate;propane |
|---|---|
| PubChem CID | 156803033 |
| Molecular Formula | C16H23ClFN3O5 |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | tert-butyl 3-[(5-chloro-6-fluoro-3-nitro-2-pyridinyl)oxy]azetidine-1-carboxylate;propane |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2nc(F)c(Cl)cc2[N+](=O)[O-])C1.CCC |
| InChI | InChI=1S/C13H15ClFN3O5.C3H8/c1-13(2,3)23-12(19)17-5-7(6-17)22-11-9(18(20)21)4-8(14)10(15)16-11;1-3-2/h4,7H,5-6H2,1-3H3;3H2,1-2H3 |
| InChIKey | KVONMOJFFFQNAA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|