About benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine
benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine (PubChem CID 156803348) has the molecular formula C19H29NO
and a molecular weight of 287.45 g/mol. Its IUPAC name is benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine.
Molecular Properties
| Compound Name | benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine |
| PubChem CID | 156803348 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine |
| SMILES | C1CCN(C2CCCCC23CCO3)CC1.c1ccccc1 |
| InChI | InChI=1S/C13H23NO.C6H6/c1-4-9-14(10-5-1)12-6-2-3-7-13(12)8-11-15-13;1-2-4-6-5-3-1/h12H,1-11H2;1-6H |
| InChIKey | ACYAGRDWEIPQNM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine?
The IUPAC name of benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine (CID 156803348) is benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine.
What is the SMILES notation for benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine?
The canonical SMILES for benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine is C1CCN(C2CCCCC23CCO3)CC1.c1ccccc1.
What is the InChIKey of benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine?
The InChIKey is ACYAGRDWEIPQNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO.C6H6/c1-4-9-14(10-5-1)12-6-2-3-7-13(12)8-11-15-13;1-2-4-6-5-3-1/h12H,1-11H2;1-6H.
What are the key properties of benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine?
benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine has a molecular weight of 287.45 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1-(1-oxaspiro[3.5]nonan-5-yl)piperidine is sourced from PubChem (CID 156803348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).