C12H21NO — CID 45098810
spiro[4,6,7,8,9,9a-hexahydro-3H-pyrido[2,1-c][1,4]oxazine-1,1'-cyclopentane] (PubChem CID 45098810) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is spiro[4,6,7,8,9,9a-hexahydro-3H-pyrido[2,1-c][1,4]oxazine-1,1'-cyclopentane].
| Compound Name | spiro[4,6,7,8,9,9a-hexahydro-3H-pyrido[2,1-c][1,4]oxazine-1,1'-cyclopentane] |
|---|---|
| PubChem CID | 45098810 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | spiro[4,6,7,8,9,9a-hexahydro-3H-pyrido[2,1-c][1,4]oxazine-1,1'-cyclopentane] |
| SMILES | C1CCN2CCOC3(CCCC3)C2C1 |
| InChI | InChI=1S/C12H21NO/c1-4-8-13-9-10-14-12(11(13)5-1)6-2-3-7-12/h11H,1-10H2 |
| InChIKey | SXUQESUGFUCHMX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |