C15H22O3S — CID 15680346
methyl (3R,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate (PubChem CID 15680346) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is methyl (3R,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate.
| Compound Name | methyl (3R,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate |
|---|---|
| PubChem CID | 15680346 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | methyl (3R,4R)-3-hydroxy-2,2-dimethyl-4-phenylsulfanylhexanoate |
| SMILES | CC[C@@H](Sc1ccccc1)[C@H](O)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C15H22O3S/c1-5-12(19-11-9-7-6-8-10-11)13(16)15(2,3)14(17)18-4/h6-10,12-13,16H,5H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | GDEGVZDIKBVCGA-OLZOCXBDSA-N |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |