C18H28O3S — CID 15680385
methyl (3R,5S)-5-butylsulfanyl-3-hydroxy-2,2-dimethyl-5-phenylpentanoate (PubChem CID 15680385) has the molecular formula C18H28O3S and a molecular weight of 324.49 g/mol. Its IUPAC name is methyl (3R,5S)-5-butylsulfanyl-3-hydroxy-2,2-dimethyl-5-phenylpentanoate.
| Compound Name | methyl (3R,5S)-5-butylsulfanyl-3-hydroxy-2,2-dimethyl-5-phenylpentanoate |
|---|---|
| PubChem CID | 15680385 |
| Molecular Formula | C18H28O3S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | methyl (3R,5S)-5-butylsulfanyl-3-hydroxy-2,2-dimethyl-5-phenylpentanoate |
| SMILES | CCCCS[C@@H](C[C@@H](O)C(C)(C)C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C18H28O3S/c1-5-6-12-22-15(14-10-8-7-9-11-14)13-16(19)18(2,3)17(20)21-4/h7-11,15-16,19H,5-6,12-13H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | VZHSHCMNCRAACM-JKSUJKDBSA-N |
| XLogP | 4.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|