About CID 156803859
CID 156803859 (PubChem CID 156803859) has the molecular formula C3H6BNO2
and a molecular weight of 98.90 g/mol.
Molecular Properties
| Compound Name | CID 156803859 |
| PubChem CID | 156803859 |
| Molecular Formula | C3H6BNO2 |
| Molecular Weight | 98.90 g/mol |
| Exact Mass | 99.05 |
| IUPAC Name | — |
| SMILES | [B]COC(=O)CN |
| InChI | InChI=1S/C3H6BNO2/c4-2-7-3(6)1-5/h1-2,5H2 |
| InChIKey | MBGZTLZQQVYTGW-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.90 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156803859 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156803859?
The IUPAC name of CID 156803859 (CID 156803859) is not available.
What is the SMILES notation for CID 156803859?
The canonical SMILES for CID 156803859 is [B]COC(=O)CN.
What is the InChIKey of CID 156803859?
The InChIKey is MBGZTLZQQVYTGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BNO2/c4-2-7-3(6)1-5/h1-2,5H2.
What are the key properties of CID 156803859?
CID 156803859 has a molecular weight of 98.90 g/mol, XLogP of -1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156803859 is sourced from PubChem (CID 156803859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).