C13H26O3S — CID 15680391
methyl (3R,4S)-5-butylsulfanyl-3-hydroxy-2,2,4-trimethylpentanoate (PubChem CID 15680391) has the molecular formula C13H26O3S and a molecular weight of 262.41 g/mol. Its IUPAC name is methyl (3R,4S)-5-butylsulfanyl-3-hydroxy-2,2,4-trimethylpentanoate.
| Compound Name | methyl (3R,4S)-5-butylsulfanyl-3-hydroxy-2,2,4-trimethylpentanoate |
|---|---|
| PubChem CID | 15680391 |
| Molecular Formula | C13H26O3S |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl (3R,4S)-5-butylsulfanyl-3-hydroxy-2,2,4-trimethylpentanoate |
| SMILES | CCCCSC[C@@H](C)[C@@H](O)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C13H26O3S/c1-6-7-8-17-9-10(2)11(14)13(3,4)12(15)16-5/h10-11,14H,6-9H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | NCFQCBJKWYBLKD-GHMZBOCLSA-N |
| XLogP | 2.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|