C10H21N3OS — CID 156804598
1-(1-methylpiperidin-4-yl)imino-1,4-thiazinane 1-oxide (PubChem CID 156804598) has the molecular formula C10H21N3OS and a molecular weight of 231.36 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)imino-1,4-thiazinane 1-oxide.
| Compound Name | 1-(1-methylpiperidin-4-yl)imino-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 156804598 |
| Molecular Formula | C10H21N3OS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)imino-1,4-thiazinane 1-oxide |
| SMILES | CN1CCC(N=S2(=O)CCNCC2)CC1 |
| InChI | InChI=1S/C10H21N3OS/c1-13-6-2-10(3-7-13)12-15(14)8-4-11-5-9-15/h10-11H,2-9H2,1H3 |
| InChIKey | WNWMQUQPYSVMFR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |