C13H20N2O2S — CID 156809670
N-butan-2-yl-4-(sulfanylmethyl)benzamide;formamide (PubChem CID 156809670) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is N-butan-2-yl-4-(sulfanylmethyl)benzamide;formamide.
| Compound Name | N-butan-2-yl-4-(sulfanylmethyl)benzamide;formamide |
|---|---|
| PubChem CID | 156809670 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-butan-2-yl-4-(sulfanylmethyl)benzamide;formamide |
| SMILES | CCC(C)NC(=O)c1ccc(CS)cc1.NC=O |
| InChI | InChI=1S/C12H17NOS.CH3NO/c1-3-9(2)13-12(14)11-6-4-10(8-15)5-7-11;2-1-3/h4-7,9,15H,3,8H2,1-2H3,(H,13,14);1H,(H2,2,3) |
| InChIKey | WKWFEDVBYQFPMD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|