C18H27NO — CID 71046019
N-butan-2-yl-4-[(E)-4,4-dimethylpent-2-en-2-yl]benzamide (PubChem CID 71046019) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is N-butan-2-yl-4-[(E)-4,4-dimethylpent-2-en-2-yl]benzamide.
| Compound Name | N-butan-2-yl-4-[(E)-4,4-dimethylpent-2-en-2-yl]benzamide |
|---|---|
| PubChem CID | 71046019 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-butan-2-yl-4-[(E)-4,4-dimethylpent-2-en-2-yl]benzamide |
| SMILES | CCC(C)NC(=O)c1ccc(/C(C)=C/C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27NO/c1-7-14(3)19-17(20)16-10-8-15(9-11-16)13(2)12-18(4,5)6/h8-12,14H,7H2,1-6H3,(H,19,20)/b13-12+ |
| InChIKey | CQDQXGOFZBCCIV-OUKQBFOZSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |