C32H35F4N3O3 — CID 156809941
2-[4-cyclopropyl-3-[(Z)-3-iminoprop-1-enyl]-5-methylphenyl]-1-[6-(4-fluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanol;ethene;formamide (PubChem CID 156809941) has the molecular formula C32H35F4N3O3 and a molecular weight of 585.64 g/mol. Its IUPAC name is 2-[4-cyclopropyl-3-[(Z)-3-iminoprop-1-enyl]-5-methylphenyl]-1-[6-(4-fluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanol;ethene;formamide.
| Compound Name | 2-[4-cyclopropyl-3-[(Z)-3-iminoprop-1-enyl]-5-methylphenyl]-1-[6-(4-fluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanol;ethene;formamide |
|---|---|
| PubChem CID | 156809941 |
| Molecular Formula | C32H35F4N3O3 |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | 2-[4-cyclopropyl-3-[(Z)-3-iminoprop-1-enyl]-5-methylphenyl]-1-[6-(4-fluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanol;ethene;formamide |
| SMILES | C=C.NC=O.[H]/N=C\C=C/c1cc(CC(O)c2cc(C)c(OCC(F)(F)F)c(-c3ccc(F)cc3)n2)cc(C)c1C1CC1 |
| InChI | InChI=1S/C29H28F4N2O2.C2H4.CH3NO/c1-17-12-19(14-22(4-3-11-34)26(17)20-5-6-20)15-25(36)24-13-18(2)28(37-16-29(31,32)33)27(35-24)21-7-9-23(30)10-8-21;1-2;2-1-3/h3-4,7-14,20,25,34,36H,5-6,15-16H2,1-2H3;1-2H2;1H,(H2,2,3)/b4-3-,34-11-;; |
| InChIKey | ILKJTLVLMWTBPK-LZGOXLDTSA-N |
| XLogP | 7.17 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|