C31H36F4N4O2 — CID 156809945
N-[2-cyclopropyl-2-[7-(4-fluorophenyl)-3-(trifluoromethyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]formamide;ethane;4-methyl-2-(methyliminomethyl)aniline (PubChem CID 156809945) has the molecular formula C31H36F4N4O2 and a molecular weight of 572.65 g/mol. Its IUPAC name is N-[2-cyclopropyl-2-[7-(4-fluorophenyl)-3-(trifluoromethyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]formamide;ethane;4-methyl-2-(methyliminomethyl)aniline.
| Compound Name | N-[2-cyclopropyl-2-[7-(4-fluorophenyl)-3-(trifluoromethyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]formamide;ethane;4-methyl-2-(methyliminomethyl)aniline |
|---|---|
| PubChem CID | 156809945 |
| Molecular Formula | C31H36F4N4O2 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | N-[2-cyclopropyl-2-[7-(4-fluorophenyl)-3-(trifluoromethyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]formamide;ethane;4-methyl-2-(methyliminomethyl)aniline |
| SMILES | C/N=C/c1cc(C)ccc1N.CC.O=CNCC(c1cc2c(c(-c3ccc(F)cc3)n1)OCC2C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C20H18F4N2O2.C9H12N2.C2H6/c21-13-5-3-12(4-6-13)18-19-14(16(9-28-19)20(22,23)24)7-17(26-18)15(8-25-10-27)11-1-2-11;1-7-3-4-9(10)8(5-7)6-11-2;1-2/h3-7,10-11,15-16H,1-2,8-9H2,(H,25,27);3-6H,10H2,1-2H3;1-2H3/b;11-6+; |
| InChIKey | YICMHPMUIWRQAX-OOYSFIBESA-N |
| XLogP | 6.82 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|