C28H28F4N2O4 — CID 123271054
4-cyclopropyloxy-3-methoxy-N-[3,3,3-trifluoro-2-[7-(4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]cyclohexa-1,3-diene-1-carboxamide (PubChem CID 123271054) has the molecular formula C28H28F4N2O4 and a molecular weight of 532.53 g/mol. Its IUPAC name is 4-cyclopropyloxy-3-methoxy-N-[3,3,3-trifluoro-2-[7-(4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 4-cyclopropyloxy-3-methoxy-N-[3,3,3-trifluoro-2-[7-(4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 123271054 |
| Molecular Formula | C28H28F4N2O4 |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 4-cyclopropyloxy-3-methoxy-N-[3,3,3-trifluoro-2-[7-(4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]cyclohexa-1,3-diene-1-carboxamide |
| SMILES | COC1=C(OC2CC2)CCC(C(=O)NCC(c2cc3c(c(-c4ccc(F)cc4)n2)OCC3C)C(F)(F)F)=C1 |
| InChI | InChI=1S/C28H28F4N2O4/c1-15-14-37-26-20(15)12-22(34-25(26)16-3-6-18(29)7-4-16)21(28(30,31)32)13-33-27(35)17-5-10-23(24(11-17)36-2)38-19-8-9-19/h3-4,6-7,11-12,15,19,21H,5,8-10,13-14H2,1-2H3,(H,33,35) |
| InChIKey | GEGCRAOGGKQCCO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |