C33H32F5N5O4 — CID 156872939
8-cyclopropyloxy-3-methyl-N-[3,3,3-trifluoro-2-[7-[4-fluoro-3-(1-fluoroethyl)phenyl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]cinnoline-6-carboxamide;formamide (PubChem CID 156872939) has the molecular formula C33H32F5N5O4 and a molecular weight of 657.64 g/mol. Its IUPAC name is 8-cyclopropyloxy-3-methyl-N-[3,3,3-trifluoro-2-[7-[4-fluoro-3-(1-fluoroethyl)phenyl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]cinnoline-6-carboxamide;formamide.
| Compound Name | 8-cyclopropyloxy-3-methyl-N-[3,3,3-trifluoro-2-[7-[4-fluoro-3-(1-fluoroethyl)phenyl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]cinnoline-6-carboxamide;formamide |
|---|---|
| PubChem CID | 156872939 |
| Molecular Formula | C33H32F5N5O4 |
| Molecular Weight | 657.64 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | 8-cyclopropyloxy-3-methyl-N-[3,3,3-trifluoro-2-[7-[4-fluoro-3-(1-fluoroethyl)phenyl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]cinnoline-6-carboxamide;formamide |
| SMILES | Cc1cc2cc(C(=O)NCC(c3cc4c(c(-c5ccc(F)c(C(C)F)c5)n3)OCC4C)C(F)(F)F)cc(OC3CC3)c2nn1.NC=O |
| InChI | InChI=1S/C32H29F5N4O3.CH3NO/c1-15-14-43-30-22(15)12-26(39-29(30)18-4-7-25(34)23(10-18)17(3)33)24(32(35,36)37)13-38-31(42)20-9-19-8-16(2)40-41-28(19)27(11-20)44-21-5-6-21;2-1-3/h4,7-12,15,17,21,24H,5-6,13-14H2,1-3H3,(H,38,42);1H,(H2,2,3) |
| InChIKey | IVJLEKWMMNMDAD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|