C31H32F3N5O2 — CID 156718248
methanamine;prop-1-yne;N-[3,3,3-trifluoro-2-[3-methyl-7-(4-methylphenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]-1,8-naphthyridine-3-carboxamide (PubChem CID 156718248) has the molecular formula C31H32F3N5O2 and a molecular weight of 563.62 g/mol. Its IUPAC name is methanamine;prop-1-yne;N-[3,3,3-trifluoro-2-[3-methyl-7-(4-methylphenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]-1,8-naphthyridine-3-carboxamide.
| Compound Name | methanamine;prop-1-yne;N-[3,3,3-trifluoro-2-[3-methyl-7-(4-methylphenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 156718248 |
| Molecular Formula | C31H32F3N5O2 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | methanamine;prop-1-yne;N-[3,3,3-trifluoro-2-[3-methyl-7-(4-methylphenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]-1,8-naphthyridine-3-carboxamide |
| SMILES | C#CC.CN.Cc1ccc(-c2nc(C(CNC(=O)c3cnc4ncccc4c3)C(F)(F)F)cc3c2OCC3C)cc1 |
| InChI | InChI=1S/C27H23F3N4O2.C3H4.CH5N/c1-15-5-7-17(8-6-15)23-24-20(16(2)14-36-24)11-22(34-23)21(27(28,29)30)13-33-26(35)19-10-18-4-3-9-31-25(18)32-12-19;1-3-2;1-2/h3-12,16,21H,13-14H2,1-2H3,(H,33,35);1H,2H3;2H2,1H3 |
| InChIKey | KXEDIMBSXFDCCP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|