C31H32FN5O4S — CID 156718084
N-[2-[7-(4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-8-[(1-methylcyclopropyl)carbamoylamino]quinoline-6-carboxamide;sulfanol (PubChem CID 156718084) has the molecular formula C31H32FN5O4S and a molecular weight of 589.69 g/mol. Its IUPAC name is N-[2-[7-(4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-8-[(1-methylcyclopropyl)carbamoylamino]quinoline-6-carboxamide;sulfanol.
| Compound Name | N-[2-[7-(4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-8-[(1-methylcyclopropyl)carbamoylamino]quinoline-6-carboxamide;sulfanol |
|---|---|
| PubChem CID | 156718084 |
| Molecular Formula | C31H32FN5O4S |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | N-[2-[7-(4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-8-[(1-methylcyclopropyl)carbamoylamino]quinoline-6-carboxamide;sulfanol |
| SMILES | CC1COc2c1cc(CCNC(=O)c1cc(NC(=O)NC3(C)CC3)c3ncccc3c1)nc2-c1ccc(F)cc1.OS |
| InChI | InChI=1S/C31H30FN5O3.H2OS/c1-18-17-40-28-24(18)16-23(35-27(28)19-5-7-22(32)8-6-19)9-13-34-29(38)21-14-20-4-3-12-33-26(20)25(15-21)36-30(39)37-31(2)10-11-31;1-2/h3-8,12,14-16,18H,9-11,13,17H2,1-2H3,(H,34,38)(H2,36,37,39);1-2H |
| InChIKey | YFGKEOGYQOHDRJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|