C17H18FN3O2 — CID 156718310
N-[7-(4-fluorophenyl)-5-[2-(methylamino)ethyl]-2,3-dihydrofuro[2,3-c]pyridin-3-yl]formamide (PubChem CID 156718310) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is N-[7-(4-fluorophenyl)-5-[2-(methylamino)ethyl]-2,3-dihydrofuro[2,3-c]pyridin-3-yl]formamide.
| Compound Name | N-[7-(4-fluorophenyl)-5-[2-(methylamino)ethyl]-2,3-dihydrofuro[2,3-c]pyridin-3-yl]formamide |
|---|---|
| PubChem CID | 156718310 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[7-(4-fluorophenyl)-5-[2-(methylamino)ethyl]-2,3-dihydrofuro[2,3-c]pyridin-3-yl]formamide |
| SMILES | CNCCc1cc2c(c(-c3ccc(F)cc3)n1)OCC2NC=O |
| InChI | InChI=1S/C17H18FN3O2/c1-19-7-6-13-8-14-15(20-10-22)9-23-17(14)16(21-13)11-2-4-12(18)5-3-11/h2-5,8,10,15,19H,6-7,9H2,1H3,(H,20,22) |
| InChIKey | NVZPLTACGLDSJV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|