C31H31Cl2FN4O4 — CID 164910611
2-chloro-N-[2-[7-(3-chloro-4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-3-methyl-8-propoxyquinoline-6-carboxamide;formamide (PubChem CID 164910611) has the molecular formula C31H31Cl2FN4O4 and a molecular weight of 613.52 g/mol. Its IUPAC name is 2-chloro-N-[2-[7-(3-chloro-4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-3-methyl-8-propoxyquinoline-6-carboxamide;formamide.
| Compound Name | 2-chloro-N-[2-[7-(3-chloro-4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-3-methyl-8-propoxyquinoline-6-carboxamide;formamide |
|---|---|
| PubChem CID | 164910611 |
| Molecular Formula | C31H31Cl2FN4O4 |
| Molecular Weight | 613.52 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | 2-chloro-N-[2-[7-(3-chloro-4-fluorophenyl)-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl]ethyl]-3-methyl-8-propoxyquinoline-6-carboxamide;formamide |
| SMILES | CCCOc1cc(C(=O)NCCc2cc3c(c(-c4ccc(F)c(Cl)c4)n2)OCC3C)cc2cc(C)c(Cl)nc12.NC=O |
| InChI | InChI=1S/C30H28Cl2FN3O3.CH3NO/c1-4-9-38-25-13-20(11-19-10-16(2)29(32)36-26(19)25)30(37)34-8-7-21-14-22-17(3)15-39-28(22)27(35-21)18-5-6-24(33)23(31)12-18;2-1-3/h5-6,10-14,17H,4,7-9,15H2,1-3H3,(H,34,37);1H,(H2,2,3) |
| InChIKey | CSQMDMHAGRXKSS-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.52 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|