C27H26FIN4O3S — CID 169241364
CID 169241364 (PubChem CID 169241364) has the molecular formula C27H26FIN4O3S and a molecular weight of 632.50 g/mol.
| Compound Name | CID 169241364 |
|---|---|
| PubChem CID | 169241364 |
| Molecular Formula | C27H26FIN4O3S |
| Molecular Weight | 632.50 g/mol |
| Exact Mass | 632.08 |
| IUPAC Name | — |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NCCc1cc2c(c(-c3ccc(F)cc3)n1)OCC2C.NI=O |
| InChI | InChI=1S/C27H24FN3O2S.H2INO/c1-16-15-33-24-22(16)14-21(31-23(24)18-8-10-20(28)11-9-18)12-13-29-26(32)25-17(2)30-27(34-25)19-6-4-3-5-7-19;2-1-3/h3-11,14,16H,12-13,15H2,1-2H3,(H,29,32);(H2,2,3) |
| InChIKey | ZBXIRFWANBBYMK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|