C16H16FN3O — CID 169240977
N-[2-[7-(4-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-5-yl]ethyl]formamide (PubChem CID 169240977) has the molecular formula C16H16FN3O and a molecular weight of 285.32 g/mol. Its IUPAC name is N-[2-[7-(4-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-5-yl]ethyl]formamide.
| Compound Name | N-[2-[7-(4-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-5-yl]ethyl]formamide |
|---|---|
| PubChem CID | 169240977 |
| Molecular Formula | C16H16FN3O |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-[2-[7-(4-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-5-yl]ethyl]formamide |
| SMILES | O=CNCCc1cc2c(c(-c3ccc(F)cc3)n1)NCC2 |
| InChI | InChI=1S/C16H16FN3O/c17-13-3-1-11(2-4-13)16-15-12(5-8-19-15)9-14(20-16)6-7-18-10-21/h1-4,9-10,19H,5-8H2,(H,18,21) |
| InChIKey | IQULRDCUCNGZOD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|