C20H22N4OS — CID 156810337
N'-(methyliminomethyl)-2-[(4R)-2-methyl-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]benzenecarboximidamide (PubChem CID 156810337) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N'-(methyliminomethyl)-2-[(4R)-2-methyl-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]benzenecarboximidamide.
| Compound Name | N'-(methyliminomethyl)-2-[(4R)-2-methyl-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 156810337 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N'-(methyliminomethyl)-2-[(4R)-2-methyl-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]benzenecarboximidamide |
| SMILES | C=CC(=O)N1Cc2sc(C)cc2[C@@H](c2ccccc2/C(N)=N\C=N\C)C1 |
| InChI | InChI=1S/C20H22N4OS/c1-4-19(25)24-10-17(16-9-13(2)26-18(16)11-24)14-7-5-6-8-15(14)20(21)23-12-22-3/h4-9,12,17H,1,10-11H2,2-3H3,(H2,21,22,23)/t17-/m1/s1 |
| InChIKey | BEUMSJQSOYFDPJ-QGZVFWFLSA-N |
| XLogP | 3.08 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|