C19H33ClFN — CID 156811577
4-[4-(2-chloro-3-fluoro-4-methylcyclohexyl)cyclohexyl]cyclohexan-1-amine (PubChem CID 156811577) has the molecular formula C19H33ClFN and a molecular weight of 329.93 g/mol. Its IUPAC name is 4-[4-(2-chloro-3-fluoro-4-methylcyclohexyl)cyclohexyl]cyclohexan-1-amine.
| Compound Name | 4-[4-(2-chloro-3-fluoro-4-methylcyclohexyl)cyclohexyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 156811577 |
| Molecular Formula | C19H33ClFN |
| Molecular Weight | 329.93 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | 4-[4-(2-chloro-3-fluoro-4-methylcyclohexyl)cyclohexyl]cyclohexan-1-amine |
| SMILES | CC1CCC(C2CCC(C3CCC(N)CC3)CC2)C(Cl)C1F |
| InChI | InChI=1S/C19H33ClFN/c1-12-2-11-17(18(20)19(12)21)15-5-3-13(4-6-15)14-7-9-16(22)10-8-14/h12-19H,2-11,22H2,1H3 |
| InChIKey | KLAXCGDAKOSQTC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.93 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|