C27H36N6O6 — CID 156812404
(12R,14S)-18-[2-(dimethylamino)ethoxy]-4-methoxy-12-(2-methoxyethoxy)-16-oxa-7,10,20,21,24-pentazapentacyclo[15.5.2.12,6.010,14.020,23]pentacosa-1(23),2(25),3,5,17(24),18,21-heptaen-11-one (PubChem CID 156812404) has the molecular formula C27H36N6O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is (12R,14S)-18-[2-(dimethylamino)ethoxy]-4-methoxy-12-(2-methoxyethoxy)-16-oxa-7,10,20,21,24-pentazapentacyclo[15.5.2.12,6.010,14.020,23]pentacosa-1(23),2(25),3,5,17(24),18,21-heptaen-11-one.
| Compound Name | (12R,14S)-18-[2-(dimethylamino)ethoxy]-4-methoxy-12-(2-methoxyethoxy)-16-oxa-7,10,20,21,24-pentazapentacyclo[15.5.2.12,6.010,14.020,23]pentacosa-1(23),2(25),3,5,17(24),18,21-heptaen-11-one |
|---|---|
| PubChem CID | 156812404 |
| Molecular Formula | C27H36N6O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | (12R,14S)-18-[2-(dimethylamino)ethoxy]-4-methoxy-12-(2-methoxyethoxy)-16-oxa-7,10,20,21,24-pentazapentacyclo[15.5.2.12,6.010,14.020,23]pentacosa-1(23),2(25),3,5,17(24),18,21-heptaen-11-one |
| SMILES | COCCO[C@@H]1C[C@H]2COc3nc4c(cnn4cc3OCCN(C)C)-c3cc(cc(OC)c3)NCCN2C1=O |
| InChI | InChI=1S/C27H36N6O6/c1-31(2)7-8-37-24-16-33-25-22(15-29-33)18-11-19(13-21(12-18)36-4)28-5-6-32-20(17-39-26(24)30-25)14-23(27(32)34)38-10-9-35-3/h11-13,15-16,20,23,28H,5-10,14,17H2,1-4H3/t20-,23+/m0/s1 |
| InChIKey | YFPVNOIBEIDMGA-NZQKXSOJSA-N |
| XLogP | 1.78 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|