C20H22F3N5O2 — CID 156815117
5-(N'-ethenylcarbamimidoyl)-2-pyrrolidin-1-ylbenzamide;5-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 156815117) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is 5-(N'-ethenylcarbamimidoyl)-2-pyrrolidin-1-ylbenzamide;5-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 5-(N'-ethenylcarbamimidoyl)-2-pyrrolidin-1-ylbenzamide;5-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 156815117 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 5-(N'-ethenylcarbamimidoyl)-2-pyrrolidin-1-ylbenzamide;5-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | C=C/N=C(\N)c1ccc(N2CCCC2)c(C(N)=O)c1.O=c1ccc(C(F)(F)F)c[nH]1 |
| InChI | InChI=1S/C14H18N4O.C6H4F3NO/c1-2-17-13(15)10-5-6-12(11(9-10)14(16)19)18-7-3-4-8-18;7-6(8,9)4-1-2-5(11)10-3-4/h2,5-6,9H,1,3-4,7-8H2,(H2,15,17)(H2,16,19);1-3H,(H,10,11) |
| InChIKey | HVBISXGXMVCCGX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|