C25H31F3N2O2 — CID 156815771
3-cyclobutyl-5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane;N-(1-hydroxybutan-2-yl)formamide (PubChem CID 156815771) has the molecular formula C25H31F3N2O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 3-cyclobutyl-5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane;N-(1-hydroxybutan-2-yl)formamide.
| Compound Name | 3-cyclobutyl-5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane;N-(1-hydroxybutan-2-yl)formamide |
|---|---|
| PubChem CID | 156815771 |
| Molecular Formula | C25H31F3N2O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 3-cyclobutyl-5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane;N-(1-hydroxybutan-2-yl)formamide |
| SMILES | CC.CCC(CO)NC=O.Fc1ccc(-c2[nH]c3c(F)cc(F)cc3c2C2CCC2)cc1 |
| InChI | InChI=1S/C18H14F3N.C5H11NO2.C2H6/c19-12-6-4-11(5-7-12)17-16(10-2-1-3-10)14-8-13(20)9-15(21)18(14)22-17;1-2-5(3-7)6-4-8;1-2/h4-10,22H,1-3H2;4-5,7H,2-3H2,1H3,(H,6,8);1-2H3 |
| InChIKey | YEYANBOOGCPDBQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|