C22H28F3N3S — CID 162389804
3-cyclobutyl-5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane;N-(methylaminosulfanyl)methanamine (PubChem CID 162389804) has the molecular formula C22H28F3N3S and a molecular weight of 423.55 g/mol. Its IUPAC name is 3-cyclobutyl-5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane;N-(methylaminosulfanyl)methanamine.
| Compound Name | 3-cyclobutyl-5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane;N-(methylaminosulfanyl)methanamine |
|---|---|
| PubChem CID | 162389804 |
| Molecular Formula | C22H28F3N3S |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 3-cyclobutyl-5,7-difluoro-2-(4-fluorophenyl)-1H-indole;ethane;N-(methylaminosulfanyl)methanamine |
| SMILES | CC.CNSNC.Fc1ccc(-c2[nH]c3c(F)cc(F)cc3c2C2CCC2)cc1 |
| InChI | InChI=1S/C18H14F3N.C2H8N2S.C2H6/c19-12-6-4-11(5-7-12)17-16(10-2-1-3-10)14-8-13(20)9-15(21)18(14)22-17;1-3-5-4-2;1-2/h4-10,22H,1-3H2;3-4H,1-2H3;1-2H3 |
| InChIKey | NTHFRYGUXPZCOU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|