C25H17F3N2O5 — CID 156816241
[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] (4-nitrophenyl) carbonate (PubChem CID 156816241) has the molecular formula C25H17F3N2O5 and a molecular weight of 482.41 g/mol. Its IUPAC name is [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] (4-nitrophenyl) carbonate.
| Compound Name | [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 156816241 |
| Molecular Formula | C25H17F3N2O5 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | [3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl] (4-nitrophenyl) carbonate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)OC1CC(c2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)C1 |
| InChI | InChI=1S/C25H17F3N2O5/c26-15-3-1-13(2-4-15)23-22(20-11-16(27)12-21(28)24(20)29-23)14-9-19(10-14)35-25(31)34-18-7-5-17(6-8-18)30(32)33/h1-8,11-12,14,19,29H,9-10H2 |
| InChIKey | PGGQWNWYTYKSED-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|