C29H24OSi — CID 15681857
(2E,4E)-5-phenyl-1-triphenylsilylpenta-2,4-dien-1-one (PubChem CID 15681857) has the molecular formula C29H24OSi and a molecular weight of 416.60 g/mol. Its IUPAC name is (2E,4E)-5-phenyl-1-triphenylsilylpenta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-phenyl-1-triphenylsilylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 15681857 |
| Molecular Formula | C29H24OSi |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (2E,4E)-5-phenyl-1-triphenylsilylpenta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H24OSi/c30-29(24-14-13-17-25-15-5-1-6-16-25)31(26-18-7-2-8-19-26,27-20-9-3-10-21-27)28-22-11-4-12-23-28/h1-24H/b17-13+,24-14+ |
| InChIKey | LVMXWACJNNFNHX-LEORQAMQSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|