About bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium
bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium (PubChem CID 6505921) has the molecular formula C34H28O2Pd
and a molecular weight of 575.02 g/mol. Its IUPAC name is bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium.
Molecular Properties
| Compound Name | bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium |
| PubChem CID | 6505921 |
| Molecular Formula | C34H28O2Pd |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium |
| SMILES | O=C(/C=C/c1ccccc1)/C=C/c1ccccc1.O=C(/C=C/c1ccccc1)/C=C/c1ccccc1.[Pd] |
| InChI | InChI=1S/2C17H14O.Pd/c2*18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;/h2*1-14H;/b2*13-11+,14-12+; |
| InChIKey | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| XLogP | 7.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium?
The IUPAC name of bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium (CID 6505921) is bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium.
What is the SMILES notation for bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium?
The canonical SMILES for bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium is O=C(/C=C/c1ccccc1)/C=C/c1ccccc1.O=C(/C=C/c1ccccc1)/C=C/c1ccccc1.[Pd].
What is the InChIKey of bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium?
The InChIKey is UKSZBOKPHAQOMP-SVLSSHOZSA-N. The full InChI is InChI=1S/2C17H14O.Pd/c2*18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;/h2*1-14H;/b2*13-11+,14-12+;.
What are the key properties of bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium?
bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium has a molecular weight of 575.02 g/mol, XLogP of 7.96, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium is sourced from PubChem (CID 6505921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).