C34H28O2Pd — CID 6505921
bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium (PubChem CID 6505921) has the molecular formula C34H28O2Pd and a molecular weight of 575.02 g/mol. Its IUPAC name is bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium.
| Compound Name | bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium |
|---|---|
| PubChem CID | 6505921 |
| Molecular Formula | C34H28O2Pd |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium |
| SMILES | O=C(/C=C/c1ccccc1)/C=C/c1ccccc1.O=C(/C=C/c1ccccc1)/C=C/c1ccccc1.[Pd] |
| InChI | InChI=1S/2C17H14O.Pd/c2*18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;/h2*1-14H;/b2*13-11+,14-12+; |
| InChIKey | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| XLogP | 7.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|