C19H16O2 — CID 5469422
(1E,6E)-1,7-diphenylhepta-1,6-diene-3,5-dione (PubChem CID 5469422) has the molecular formula C19H16O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is (1E,6E)-1,7-diphenylhepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-diphenylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 5469422 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (1E,6E)-1,7-diphenylhepta-1,6-diene-3,5-dione |
| SMILES | O=C(/C=C/c1ccccc1)CC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H16O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-14H,15H2/b13-11+,14-12+ |
| InChIKey | UXLWOYFDJVFCBR-PHEQNACWSA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|