C15H17N3 — CID 156818619
(6-phenyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl)methanamine (PubChem CID 156818619) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is (6-phenyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl)methanamine.
| Compound Name | (6-phenyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl)methanamine |
|---|---|
| PubChem CID | 156818619 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | (6-phenyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl)methanamine |
| SMILES | NCc1cc2c(cn1)CCN(c1ccccc1)C2 |
| InChI | InChI=1S/C15H17N3/c16-9-14-8-13-11-18(7-6-12(13)10-17-14)15-4-2-1-3-5-15/h1-5,8,10H,6-7,9,11,16H2 |
| InChIKey | OJMQUZQHBVNZNE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |